C12H9F2NO3 — CID 43477022
1-[2-(difluoromethoxy)phenyl]pyrrole-2-carboxylic acid (PubChem CID 43477022) has the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43477022 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1-c1ccccc1OC(F)F |
| InChI | InChI=1S/C12H9F2NO3/c13-12(14)18-10-6-2-1-4-8(10)15-7-3-5-9(15)11(16)17/h1-7,12H,(H,16,17) |
| InChIKey | YGZNDWFCUWDXDA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |