C9H8ClN3O4 — CID 43513395
2-(3-chloropropyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole (PubChem CID 43513395) has the molecular formula C9H8ClN3O4 and a molecular weight of 257.63 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43513395 |
| Molecular Formula | C9H8ClN3O4 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-(3-chloropropyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(CCCCl)o2)o1 |
| InChI | InChI=1S/C9H8ClN3O4/c10-5-1-2-7-11-12-9(17-7)6-3-4-8(16-6)13(14)15/h3-4H,1-2,5H2 |
| InChIKey | ZIOZJFSNDGXTQN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|