C7H9F3N4O2 — CID 43554241
1,3-dimethyl-4-nitro-N-(2,2,2-trifluoroethyl)pyrazol-5-amine (PubChem CID 43554241) has the molecular formula C7H9F3N4O2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-(2,2,2-trifluoroethyl)pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43554241 |
| Molecular Formula | C7H9F3N4O2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9F3N4O2/c1-4-5(14(15)16)6(13(2)12-4)11-3-7(8,9)10/h11H,3H2,1-2H3 |
| InChIKey | ANYRHQYIFUAVGD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|