C7H13N3S — CID 43554540
5-ethylsulfanyl-1,3-dimethylpyrazol-4-amine (PubChem CID 43554540) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 5-ethylsulfanyl-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-ethylsulfanyl-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 43554540 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 5-ethylsulfanyl-1,3-dimethylpyrazol-4-amine |
| SMILES | CCSc1c(N)c(C)nn1C |
| InChI | InChI=1S/C7H13N3S/c1-4-11-7-6(8)5(2)9-10(7)3/h4,8H2,1-3H3 |
| InChIKey | GELGRUADOMYEGG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |