C10H17N3S — CID 63114516
5-cyclopentylsulfanyl-1,3-dimethylpyrazol-4-amine (PubChem CID 63114516) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 5-cyclopentylsulfanyl-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 63114516 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(SC2CCCC2)c1N |
| InChI | InChI=1S/C10H17N3S/c1-7-9(11)10(13(2)12-7)14-8-5-3-4-6-8/h8H,3-6,11H2,1-2H3 |
| InChIKey | CDGAPABEVKAKOU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |