C16H17ClN2O2 — CID 43558014
2-(3-chlorophenyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione (PubChem CID 43558014) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione.
| Compound Name | 2-(3-chlorophenyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
|---|---|
| PubChem CID | 43558014 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(3-chlorophenyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
| SMILES | O=C1C2CC3CCCCC3N2C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-11-5-3-6-12(9-11)18-15(20)14-8-10-4-1-2-7-13(10)19(14)16(18)21/h3,5-6,9-10,13-14H,1-2,4,7-8H2 |
| InChIKey | UZRXJEQHTIYVCH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|