C14H19BrN2O2S — CID 43598524
(3aR,7aS)-2-(3-bromophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 43598524) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is (3aR,7aS)-2-(3-bromophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(3-bromophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 43598524 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (3aR,7aS)-2-(3-bromophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | NC1CC[C@@H]2CN(S(=O)(=O)c3cccc(Br)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H19BrN2O2S/c15-12-2-1-3-14(7-12)20(18,19)17-8-10-4-5-13(16)6-11(10)9-17/h1-3,7,10-11,13H,4-6,8-9,16H2/t10-,11+,13?/m1/s1 |
| InChIKey | XEWJRUKSAOPYTN-ILWADHIDSA-N |
| XLogP | 2.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |