C13H21N3O2S — CID 43598589
(3aR,7aS)-2-(1-methylpyrrol-3-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 43598589) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (3aR,7aS)-2-(1-methylpyrrol-3-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(1-methylpyrrol-3-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 43598589 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3aR,7aS)-2-(1-methylpyrrol-3-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | Cn1ccc(S(=O)(=O)N2C[C@H]3CCC(N)C[C@H]3C2)c1 |
| InChI | InChI=1S/C13H21N3O2S/c1-15-5-4-13(9-15)19(17,18)16-7-10-2-3-12(14)6-11(10)8-16/h4-5,9-12H,2-3,6-8,14H2,1H3/t10-,11+,12?/m1/s1 |
| InChIKey | XHACYPKDZJUKGG-UBNQGINQSA-N |
| XLogP | 0.77 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |