C7H13N3O3S2 — CID 43605742
N-(3-aminopropyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 43605742) has the molecular formula C7H13N3O3S2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(3-aminopropyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43605742 |
| Molecular Formula | C7H13N3O3S2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | N-(3-aminopropyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCCCN |
| InChI | InChI=1S/C7H13N3O3S2/c1-5-6(14-7(11)10-5)15(12,13)9-4-2-3-8/h9H,2-4,8H2,1H3,(H,10,11) |
| InChIKey | NDZTXWDTHANGTR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|