C6H9ClN4OS — CID 43625562
2-[(5-chlorothiadiazol-4-yl)methyl-methylamino]acetamide (PubChem CID 43625562) has the molecular formula C6H9ClN4OS and a molecular weight of 220.68 g/mol. Its IUPAC name is 2-[(5-chlorothiadiazol-4-yl)methyl-methylamino]acetamide.
| Compound Name | 2-[(5-chlorothiadiazol-4-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 43625562 |
| Molecular Formula | C6H9ClN4OS |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-[(5-chlorothiadiazol-4-yl)methyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)Cc1nnsc1Cl |
| InChI | InChI=1S/C6H9ClN4OS/c1-11(3-5(8)12)2-4-6(7)13-10-9-4/h2-3H2,1H3,(H2,8,12) |
| InChIKey | FPBCHAYLBHTJJF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |