C11H16N2O3 — CID 43627572
8-[[methoxy(methyl)amino]methyl]-4H-1,3-benzodioxin-6-amine (PubChem CID 43627572) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 8-[[methoxy(methyl)amino]methyl]-4H-1,3-benzodioxin-6-amine.
| Compound Name | 8-[[methoxy(methyl)amino]methyl]-4H-1,3-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43627572 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 8-[[methoxy(methyl)amino]methyl]-4H-1,3-benzodioxin-6-amine |
| SMILES | CON(C)Cc1cc(N)cc2c1OCOC2 |
| InChI | InChI=1S/C11H16N2O3/c1-13(14-2)5-8-3-10(12)4-9-6-15-7-16-11(8)9/h3-4H,5-7,12H2,1-2H3 |
| InChIKey | RQGLCBKTEDOGOU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|