C15H21N3O3 — CID 63284651
3-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl-(2-methoxyethyl)amino]propanenitrile (PubChem CID 63284651) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 63284651 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)Cc1cc(N)cc2c1OCOC2 |
| InChI | InChI=1S/C15H21N3O3/c1-19-6-5-18(4-2-3-16)9-12-7-14(17)8-13-10-20-11-21-15(12)13/h7-8H,2,4-6,9-11,17H2,1H3 |
| InChIKey | OCYANZQSUKEZNY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|