C9H9N5O — CID 43642564
4-amino-N,N-bis(cyanomethyl)-1H-pyrrole-2-carboxamide (PubChem CID 43642564) has the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-amino-N,N-bis(cyanomethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N,N-bis(cyanomethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43642564 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-amino-N,N-bis(cyanomethyl)-1H-pyrrole-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1cc(N)c[nH]1 |
| InChI | InChI=1S/C9H9N5O/c10-1-3-14(4-2-11)9(15)8-5-7(12)6-13-8/h5-6,13H,3-4,12H2 |
| InChIKey | RNXZGAKTUYMNQD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|