C13H11N5O — CID 61090071
6-amino-N,N-bis(cyanomethyl)-1H-indole-3-carboxamide (PubChem CID 61090071) has the molecular formula C13H11N5O and a molecular weight of 253.26 g/mol. Its IUPAC name is 6-amino-N,N-bis(cyanomethyl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N,N-bis(cyanomethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 61090071 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 6-amino-N,N-bis(cyanomethyl)-1H-indole-3-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C13H11N5O/c14-3-5-18(6-4-15)13(19)11-8-17-12-7-9(16)1-2-10(11)12/h1-2,7-8,17H,5-6,16H2 |
| InChIKey | WGHKGOUWBCTXQI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|