C15H15N5O — CID 61116492
6-amino-N,N-bis(2-cyanoethyl)-1H-indole-3-carboxamide (PubChem CID 61116492) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-amino-N,N-bis(2-cyanoethyl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N,N-bis(2-cyanoethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 61116492 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 6-amino-N,N-bis(2-cyanoethyl)-1H-indole-3-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C15H15N5O/c16-5-1-7-20(8-2-6-17)15(21)13-10-19-14-9-11(18)3-4-12(13)14/h3-4,9-10,19H,1-2,7-8,18H2 |
| InChIKey | BHUIEBPGOTXPCY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|