C14H18N4O2S — CID 43673426
1,1-dioxo-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine (PubChem CID 43673426) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1,1-dioxo-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 43673426 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,1-dioxo-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc(Cn3cncn3)cc2)CC1 |
| InChI | InChI=1S/C14H18N4O2S/c19-21(20)7-5-14(6-8-21)17-13-3-1-12(2-4-13)9-18-11-15-10-16-18/h1-4,10-11,14,17H,5-9H2 |
| InChIKey | QOHUNUJADKEYNC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |