C17H24N4 — CID 64761194
N-(2,3-dimethylcyclohexyl)-4-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 64761194) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-4-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | N-(2,3-dimethylcyclohexyl)-4-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 64761194 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-4-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | CC1CCCC(Nc2ccc(Cn3cncn3)cc2)C1C |
| InChI | InChI=1S/C17H24N4/c1-13-4-3-5-17(14(13)2)20-16-8-6-15(7-9-16)10-21-12-18-11-19-21/h6-9,11-14,17,20H,3-5,10H2,1-2H3 |
| InChIKey | BCVVEXBHTAMXTB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |