C15H29NO2S — CID 43679757
N-(4-tert-butylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 43679757) has the molecular formula C15H29NO2S and a molecular weight of 287.47 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-(4-tert-butylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43679757 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC1(NC2CCC(C(C)(C)C)CC2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H29NO2S/c1-14(2,3)12-5-7-13(8-6-12)16-15(4)9-10-19(17,18)11-15/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | MYXBCVWCRJAFHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |