C15H18N2O4 — CID 43688370
4-[[[6-(2-methoxyethoxy)-3-pyridinyl]amino]methyl]benzene-1,3-diol (PubChem CID 43688370) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[[[6-(2-methoxyethoxy)-3-pyridinyl]amino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[[6-(2-methoxyethoxy)-3-pyridinyl]amino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43688370 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[[[6-(2-methoxyethoxy)-3-pyridinyl]amino]methyl]benzene-1,3-diol |
| SMILES | COCCOc1ccc(NCc2ccc(O)cc2O)cn1 |
| InChI | InChI=1S/C15H18N2O4/c1-20-6-7-21-15-5-3-12(10-17-15)16-9-11-2-4-13(18)8-14(11)19/h2-5,8,10,16,18-19H,6-7,9H2,1H3 |
| InChIKey | PTELDPYGMGCEDS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|