About 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol
1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43726758) has the molecular formula C19H25NO
and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 43726758 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C19H25NO/c21-19-6-2-5-14-15(19)7-8-17(14)20-18-10-11-9-16(18)13-4-1-3-12(11)13/h2,5-6,11-13,16-18,20-21H,1,3-4,7-10H2 |
| InChIKey | JGNICSCRTRYSLS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol (CID 43726758) is 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol is Oc1cccc2c1CCC2NC1CC2CC1C1CCCC21.
What is the InChIKey of 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol?
The InChIKey is JGNICSCRTRYSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO/c21-19-6-2-5-14-15(19)7-8-17(14)20-18-10-11-9-16(18)13-4-1-3-12(11)13/h2,5-6,11-13,16-18,20-21H,1,3-4,7-10H2.
What are the key properties of 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol?
1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol has a molecular weight of 283.41 g/mol, XLogP of 3.79, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 43726758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).