C19H25NO — CID 43726758
1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43726758) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43726758 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(8-tricyclo[5.2.1.02,6]decanylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C19H25NO/c21-19-6-2-5-14-15(19)7-8-17(14)20-18-10-11-9-16(18)13-4-1-3-12(11)13/h2,5-6,11-13,16-18,20-21H,1,3-4,7-10H2 |
| InChIKey | JGNICSCRTRYSLS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |