C14H19NO2 — CID 83228932
1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 83228932) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 83228932 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NOC1CCCC1 |
| InChI | InChI=1S/C14H19NO2/c16-14-7-3-6-11-12(14)8-9-13(11)15-17-10-4-1-2-5-10/h3,6-7,10,13,15-16H,1-2,4-5,8-9H2 |
| InChIKey | AALXSBVOBNYOBP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|