About 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol
1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 83228932) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 83228932 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NOC1CCCC1 |
| InChI | InChI=1S/C14H19NO2/c16-14-7-3-6-11-12(14)8-9-13(11)15-17-10-4-1-2-5-10/h3,6-7,10,13,15-16H,1-2,4-5,8-9H2 |
| InChIKey | AALXSBVOBNYOBP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol (CID 83228932) is 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol is Oc1cccc2c1CCC2NOC1CCCC1.
What is the InChIKey of 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol?
The InChIKey is AALXSBVOBNYOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c16-14-7-3-6-11-12(14)8-9-13(11)15-17-10-4-1-2-5-10/h3,6-7,10,13,15-16H,1-2,4-5,8-9H2.
What are the key properties of 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol?
1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol has a molecular weight of 233.31 g/mol, XLogP of 2.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentyloxyamino)-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 83228932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).