C15H28N2O2S — CID 43747930
N-(cyclohex-3-en-1-ylmethyl)-1-propylsulfonylpiperidin-4-amine (PubChem CID 43747930) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-1-propylsulfonylpiperidin-4-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-1-propylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 43747930 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-1-propylsulfonylpiperidin-4-amine |
| SMILES | CCCS(=O)(=O)N1CCC(NCC2CC=CCC2)CC1 |
| InChI | InChI=1S/C15H28N2O2S/c1-2-12-20(18,19)17-10-8-15(9-11-17)16-13-14-6-4-3-5-7-14/h3-4,14-16H,2,5-13H2,1H3 |
| InChIKey | JTGTYLKHLQJEJT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|