C14H17F2N3 — CID 43759683
N-[(1-tert-butylpyrazol-4-yl)methyl]-2,5-difluoroaniline (PubChem CID 43759683) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[(1-tert-butylpyrazol-4-yl)methyl]-2,5-difluoroaniline.
| Compound Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 43759683 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-2,5-difluoroaniline |
| SMILES | CC(C)(C)n1cc(CNc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C14H17F2N3/c1-14(2,3)19-9-10(8-18-19)7-17-13-6-11(15)4-5-12(13)16/h4-6,8-9,17H,7H2,1-3H3 |
| InChIKey | VFCBKSWHLLVNCP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |