C16H26N4S — CID 43763148
N',N'-diethyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,3-diamine (PubChem CID 43763148) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is N',N'-diethyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43763148 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N',N'-diethyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNC(c1cccs1)c1nccn1C |
| InChI | InChI=1S/C16H26N4S/c1-4-20(5-2)11-7-9-17-15(14-8-6-13-21-14)16-18-10-12-19(16)3/h6,8,10,12-13,15,17H,4-5,7,9,11H2,1-3H3 |
| InChIKey | VJZAXHHPKUWQLF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|