C12H17N3OS — CID 43770573
3-[[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]amino]propan-1-ol (PubChem CID 43770573) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-[[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]amino]propan-1-ol.
| Compound Name | 3-[[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 43770573 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-[[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]amino]propan-1-ol |
| SMILES | Cn1ccnc1C(NCCCO)c1cccs1 |
| InChI | InChI=1S/C12H17N3OS/c1-15-7-6-14-12(15)11(13-5-3-8-16)10-4-2-9-17-10/h2,4,6-7,9,11,13,16H,3,5,8H2,1H3 |
| InChIKey | GKQLTSKWVXSZSN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|