C9H11N3OS — CID 82685624
N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]hydroxylamine (PubChem CID 82685624) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]hydroxylamine.
| Compound Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]hydroxylamine |
|---|---|
| PubChem CID | 82685624 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]hydroxylamine |
| SMILES | Cn1ccnc1C(NO)c1cccs1 |
| InChI | InChI=1S/C9H11N3OS/c1-12-5-4-10-9(12)8(11-13)7-3-2-6-14-7/h2-6,8,11,13H,1H3 |
| InChIKey | IHBVSSNWNAUJQH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|