C15H17N3S2 — CID 43770265
N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-1-thiophen-2-ylethanamine (PubChem CID 43770265) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43770265 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-1-thiophen-2-ylethanamine |
| SMILES | CC(NC(c1cccs1)c1nccn1C)c1cccs1 |
| InChI | InChI=1S/C15H17N3S2/c1-11(12-5-3-9-19-12)17-14(13-6-4-10-20-13)15-16-7-8-18(15)2/h3-11,14,17H,1-2H3 |
| InChIKey | QIDXWBFMPJSDHY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |