About 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine
2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine (PubChem CID 54913424) has the molecular formula C14H22N4S
and a molecular weight of 278.43 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine |
| PubChem CID | 54913424 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine |
| SMILES | CC(CNC(c1cccs1)c1nccn1C)N(C)C |
| InChI | InChI=1S/C14H22N4S/c1-11(17(2)3)10-16-13(12-6-5-9-19-12)14-15-7-8-18(14)4/h5-9,11,13,16H,10H2,1-4H3 |
| InChIKey | YNFYFWSBPMHXCD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine?
The IUPAC name of 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine (CID 54913424) is 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine is CC(CNC(c1cccs1)c1nccn1C)N(C)C.
What is the InChIKey of 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine?
The InChIKey is YNFYFWSBPMHXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4S/c1-11(17(2)3)10-16-13(12-6-5-9-19-12)14-15-7-8-18(14)4/h5-9,11,13,16H,10H2,1-4H3.
What are the key properties of 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine?
2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine has a molecular weight of 278.43 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-1-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]propane-1,2-diamine is sourced from PubChem (CID 54913424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).