C14H21N3S2 — CID 63981936
2-methyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-3-methylsulfanylpropan-1-amine (PubChem CID 63981936) has the molecular formula C14H21N3S2 and a molecular weight of 295.48 g/mol. Its IUPAC name is 2-methyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | 2-methyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 63981936 |
| Molecular Formula | C14H21N3S2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-methyl-N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCC(C)CNC(c1cccs1)c1nccn1C |
| InChI | InChI=1S/C14H21N3S2/c1-11(10-18-3)9-16-13(12-5-4-8-19-12)14-15-6-7-17(14)2/h4-8,11,13,16H,9-10H2,1-3H3 |
| InChIKey | LLXWIJDEBGZUBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |