C15H22N4S2 — CID 103917506
N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-thiomorpholin-4-ylethanamine (PubChem CID 103917506) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-thiomorpholin-4-ylethanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-thiomorpholin-4-ylethanamine |
|---|---|
| PubChem CID | 103917506 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-thiomorpholin-4-ylethanamine |
| SMILES | Cn1ccnc1C(NCCN1CCSCC1)c1cccs1 |
| InChI | InChI=1S/C15H22N4S2/c1-18-6-4-17-15(18)14(13-3-2-10-21-13)16-5-7-19-8-11-20-12-9-19/h2-4,6,10,14,16H,5,7-9,11-12H2,1H3 |
| InChIKey | GSOWMBZTSLQBLG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |