C14H20F2N2OS — CID 43763493
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43763493) has the molecular formula C14H20F2N2OS and a molecular weight of 302.39 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43763493 |
| Molecular Formula | C14H20F2N2OS |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | FC(F)SCc1ccc(CNC2CN3CCC2CC3)o1 |
| InChI | InChI=1S/C14H20F2N2OS/c15-14(16)20-9-12-2-1-11(19-12)7-17-13-8-18-5-3-10(13)4-6-18/h1-2,10,13-14,17H,3-9H2 |
| InChIKey | ZMJAVDHUUTWTKH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |