C15H18ClNOS2 — CID 43792331
3-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]cyclohexan-1-ol (PubChem CID 43792331) has the molecular formula C15H18ClNOS2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 3-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]cyclohexan-1-ol.
| Compound Name | 3-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 43792331 |
| Molecular Formula | C15H18ClNOS2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 3-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]cyclohexan-1-ol |
| SMILES | OC1CCCC(NC(c2cccs2)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C15H18ClNOS2/c16-14-7-6-13(20-14)15(12-5-2-8-19-12)17-10-3-1-4-11(18)9-10/h2,5-8,10-11,15,17-18H,1,3-4,9H2 |
| InChIKey | UNHXBHLPZZNEOL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |