C21H21ClN6OS — CID 43814742
3-(2-chlorophenyl)-1-(2-methoxyethyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea (PubChem CID 43814742) has the molecular formula C21H21ClN6OS and a molecular weight of 440.96 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(2-methoxyethyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea.
| Compound Name | 3-(2-chlorophenyl)-1-(2-methoxyethyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 43814742 |
| Molecular Formula | C21H21ClN6OS |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(2-methoxyethyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
| SMILES | COCCN(Cc1cc2cc(C)ccc2n2nnnc12)C(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H21ClN6OS/c1-14-7-8-19-15(11-14)12-16(20-24-25-26-28(19)20)13-27(9-10-29-2)21(30)23-18-6-4-3-5-17(18)22/h3-8,11-12H,9-10,13H2,1-2H3,(H,23,30) |
| InChIKey | MRRYEALYPKCUCY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|