C21H23N5O4 — CID 43817843
[2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]phenyl]methanone (PubChem CID 43817843) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]phenyl]methanone.
| Compound Name | [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 43817843 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]phenyl]methanone |
| SMILES | Cc1cc(C2CCCCCN2C(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)cc2)on1 |
| InChI | InChI=1S/C21H23N5O4/c1-15-11-20(30-23-15)19-5-3-2-4-10-25(19)21(27)17-8-6-16(7-9-17)13-24-14-18(12-22-24)26(28)29/h6-9,11-12,14,19H,2-5,10,13H2,1H3 |
| InChIKey | ZSJMYMAVXDWPDY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 107.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|