C16H25N5O3S — CID 43819234
ethyl 5-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]thiadiazole-4-carboxylate (PubChem CID 43819234) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is ethyl 5-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 43819234 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | ethyl 5-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H25N5O3S/c1-2-24-15(22)13-14(25-19-18-13)17-16(23)21-10-6-12(7-11-21)20-8-4-3-5-9-20/h12H,2-11H2,1H3,(H,17,23) |
| InChIKey | HXEHDDQYRUGGAF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |