C14H13N5O2S3 — CID 43819427
N-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethylcarbamoylamino)thiadiazole-4-carboxamide (PubChem CID 43819427) has the molecular formula C14H13N5O2S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethylcarbamoylamino)thiadiazole-4-carboxamide.
| Compound Name | N-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethylcarbamoylamino)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 43819427 |
| Molecular Formula | C14H13N5O2S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethylcarbamoylamino)thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)Nc1snnc1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C14H13N5O2S3/c20-12(15-7-9-3-1-5-22-9)11-13(24-19-18-11)17-14(21)16-8-10-4-2-6-23-10/h1-6H,7-8H2,(H,15,20)(H2,16,17,21) |
| InChIKey | CNLZHESIMIENDK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |