C21H21N3O5S — CID 43831697
6-methoxy-4-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-quinoline-3-carboxamide (PubChem CID 43831697) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 6-methoxy-4-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-quinoline-3-carboxamide.
| Compound Name | 6-methoxy-4-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 43831697 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-methoxy-4-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc2[nH]cc(C(=O)Nc3ccc(S(=O)(=O)N4CCCC4)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C21H21N3O5S/c1-29-15-6-9-19-17(12-15)20(25)18(13-22-19)21(26)23-14-4-7-16(8-5-14)30(27,28)24-10-2-3-11-24/h4-9,12-13H,2-3,10-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | AARLOZBEYLMJGO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |