C22H18N2O4S2 — CID 43842457
2-(9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-10-yl)-N-(3-methylphenyl)acetamide (PubChem CID 43842457) has the molecular formula C22H18N2O4S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-(9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-10-yl)-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-10-yl)-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43842457 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2-(9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-10-yl)-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CC23CSc4[nH]c(=O)sc4C2c2ccccc2OC3=O)c1 |
| InChI | InChI=1S/C22H18N2O4S2/c1-12-5-4-6-13(9-12)23-16(25)10-22-11-29-19-18(30-21(27)24-19)17(22)14-7-2-3-8-15(14)28-20(22)26/h2-9,17H,10-11H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | RTYKHDNSCSRPPR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|