C21H20N2O8S — CID 43853570
dimethyl 2-[[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]sulfonylamino]benzene-1,4-dicarboxylate (PubChem CID 43853570) has the molecular formula C21H20N2O8S and a molecular weight of 460.46 g/mol. Its IUPAC name is dimethyl 2-[[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]sulfonylamino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]sulfonylamino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 43853570 |
| Molecular Formula | C21H20N2O8S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | dimethyl 2-[[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]sulfonylamino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NS(=O)(=O)c2ccc(N3C(=O)CCC3=O)c(C)c2)c1 |
| InChI | InChI=1S/C21H20N2O8S/c1-12-10-14(5-7-17(12)23-18(24)8-9-19(23)25)32(28,29)22-16-11-13(20(26)30-2)4-6-15(16)21(27)31-3/h4-7,10-11,22H,8-9H2,1-3H3 |
| InChIKey | IVNZUXRBKBGQJX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|