C21H25NO2 — CID 43912618
3-[(2-butoxyphenyl)methyl]-5,7-dimethyl-1,3-dihydroindol-2-one (PubChem CID 43912618) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[(2-butoxyphenyl)methyl]-5,7-dimethyl-1,3-dihydroindol-2-one.
| Compound Name | 3-[(2-butoxyphenyl)methyl]-5,7-dimethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43912618 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-[(2-butoxyphenyl)methyl]-5,7-dimethyl-1,3-dihydroindol-2-one |
| SMILES | CCCCOc1ccccc1CC1C(=O)Nc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H25NO2/c1-4-5-10-24-19-9-7-6-8-16(19)13-18-17-12-14(2)11-15(3)20(17)22-21(18)23/h6-9,11-12,18H,4-5,10,13H2,1-3H3,(H,22,23) |
| InChIKey | HXQQNBUCRBCZRM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|