C20H20ClFN4O2S — CID 43949763
3-[(2-chloro-6-fluorophenyl)methoxy]-4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,5-thiadiazole (PubChem CID 43949763) has the molecular formula C20H20ClFN4O2S and a molecular weight of 434.92 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methoxy]-4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,5-thiadiazole.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methoxy]-4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43949763 |
| Molecular Formula | C20H20ClFN4O2S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methoxy]-4-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,5-thiadiazole |
| SMILES | COc1ccc(N2CCN(c3nsnc3OCc3c(F)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H20ClFN4O2S/c1-27-15-7-5-14(6-8-15)25-9-11-26(12-10-25)19-20(24-29-23-19)28-13-16-17(21)3-2-4-18(16)22/h2-8H,9-13H2,1H3 |
| InChIKey | DRSAQDRVFFNCRR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|