C24H25ClN2O3S — CID 43979572
1-(4-chlorophenyl)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopentane-1-carboxamide (PubChem CID 43979572) has the molecular formula C24H25ClN2O3S and a molecular weight of 457.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 43979572 |
| Molecular Formula | C24H25ClN2O3S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopentane-1-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2(c3ccc(Cl)cc3)CCCC2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C24H25ClN2O3S/c1-4-13-27-18-14-19(29-2)20(30-3)15-21(18)31-23(27)26-22(28)24(11-5-6-12-24)16-7-9-17(25)10-8-16/h4,7-10,14-15H,1,5-6,11-13H2,2-3H3/b26-23- |
| InChIKey | ZUHKQIUUGMMFNL-RWEWTDSWSA-N |
| XLogP | 5.50 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|