C26H34N4O6S — CID 44511769
tert-butyl N-[(2S)-1-[2-[2-(2-ethylanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxo-3-phenoxybutan-2-yl]carbamate (PubChem CID 44511769) has the molecular formula C26H34N4O6S and a molecular weight of 530.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-[2-(2-ethylanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxo-3-phenoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-[2-(2-ethylanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxo-3-phenoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 44511769 |
| Molecular Formula | C26H34N4O6S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-[2-(2-ethylanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxo-3-phenoxybutan-2-yl]carbamate |
| SMILES | CCc1ccccc1NC(=O)CSC(=O)NNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)Oc1ccccc1 |
| InChI | InChI=1S/C26H34N4O6S/c1-6-18-12-10-11-15-20(18)27-21(31)16-37-25(34)30-29-23(32)22(28-24(33)36-26(3,4)5)17(2)35-19-13-8-7-9-14-19/h7-15,17,22H,6,16H2,1-5H3,(H,27,31)(H,28,33)(H,29,32)(H,30,34)/t17?,22-/m0/s1 |
| InChIKey | FCRBSRTWIGMCIA-UGNFMNBCSA-N |
| XLogP | 4.02 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|