C27H35N5O8S — CID 88910496
tert-butyl N-[(2S)-3-(4-butoxyphenyl)-1-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 88910496) has the molecular formula C27H35N5O8S and a molecular weight of 589.67 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(4-butoxyphenyl)-1-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(4-butoxyphenyl)-1-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88910496 |
| Molecular Formula | C27H35N5O8S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | tert-butyl N-[(2S)-3-(4-butoxyphenyl)-1-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)SCC(=O)Nc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H35N5O8S/c1-5-6-15-39-19-13-11-18(12-14-19)16-21(29-25(35)40-27(2,3)4)24(34)30-31-26(36)41-17-23(33)28-20-9-7-8-10-22(20)32(37)38/h7-14,21H,5-6,15-17H2,1-4H3,(H,28,33)(H,29,35)(H,30,34)(H,31,36)/t21-/m0/s1 |
| InChIKey | RHYIKHUJQDPEBC-NRFANRHFSA-N |
| XLogP | 4.32 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|