C25H25N5O — CID 44513333
8,11-diphenyl-13-pyrrolidin-1-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one (PubChem CID 44513333) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 8,11-diphenyl-13-pyrrolidin-1-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one.
| Compound Name | 8,11-diphenyl-13-pyrrolidin-1-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one |
|---|---|
| PubChem CID | 44513333 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 8,11-diphenyl-13-pyrrolidin-1-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one |
| SMILES | O=C1N(c2ccccc2)c2nc(-c3ccccc3)nc(N3CCCC3)c2C2CCCN12 |
| InChI | InChI=1S/C25H25N5O/c31-25-29-17-9-14-20(29)21-23(28-15-7-8-16-28)26-22(18-10-3-1-4-11-18)27-24(21)30(25)19-12-5-2-6-13-19/h1-6,10-13,20H,7-9,14-17H2 |
| InChIKey | HKSOQEHRTYHNDC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |