C26H27N5O2S — CID 122180796
11-(4-methoxyphenyl)-13-morpholin-4-yl-8-phenyl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione (PubChem CID 122180796) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-13-morpholin-4-yl-8-phenyl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione.
| Compound Name | 11-(4-methoxyphenyl)-13-morpholin-4-yl-8-phenyl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione |
|---|---|
| PubChem CID | 122180796 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 11-(4-methoxyphenyl)-13-morpholin-4-yl-8-phenyl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione |
| SMILES | COc1ccc(-c2nc(N3CCOCC3)c3c(n2)N(c2ccccc2)C(=S)N2CCCC32)cc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-32-20-11-9-18(10-12-20)23-27-24(29-14-16-33-17-15-29)22-21-8-5-13-30(21)26(34)31(25(22)28-23)19-6-3-2-4-7-19/h2-4,6-7,9-12,21H,5,8,13-17H2,1H3 |
| InChIKey | CLNISIBMROADFZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|