C15H30O2 — CID 44517874
[(2S,3S)-3-[(2R,4R,6R)-4,6,8-trimethylnonan-2-yl]oxiran-2-yl]methanol (PubChem CID 44517874) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is [(2S,3S)-3-[(2R,4R,6R)-4,6,8-trimethylnonan-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(2R,4R,6R)-4,6,8-trimethylnonan-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 44517874 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | [(2S,3S)-3-[(2R,4R,6R)-4,6,8-trimethylnonan-2-yl]oxiran-2-yl]methanol |
| SMILES | CC(C)C[C@@H](C)C[C@@H](C)C[C@@H](C)[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C15H30O2/c1-10(2)6-11(3)7-12(4)8-13(5)15-14(9-16)17-15/h10-16H,6-9H2,1-5H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | ZOVNVEZQUDOXKG-ZSAUSMIDSA-N |
| XLogP | 3.48 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|