C20H36OSi — CID 44517963
(Z,3S)-3-[2-tri(propan-2-yl)silylethynyl]non-6-enal (PubChem CID 44517963) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is (Z,3S)-3-[2-tri(propan-2-yl)silylethynyl]non-6-enal.
| Compound Name | (Z,3S)-3-[2-tri(propan-2-yl)silylethynyl]non-6-enal |
|---|---|
| PubChem CID | 44517963 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (Z,3S)-3-[2-tri(propan-2-yl)silylethynyl]non-6-enal |
| SMILES | CC/C=C\CC[C@H](C#C[Si](C(C)C)(C(C)C)C(C)C)CC=O |
| InChI | InChI=1S/C20H36OSi/c1-8-9-10-11-12-20(13-15-21)14-16-22(17(2)3,18(4)5)19(6)7/h9-10,15,17-20H,8,11-13H2,1-7H3/b10-9-/t20-/m0/s1 |
| InChIKey | LASBBPQSWIAWFV-QJRAZLAKSA-N |
| XLogP | 6.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|