C20H22N6O2 — CID 44520468
(E)-1-[4-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 44520468) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is (E)-1-[4-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 44520468 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (E)-1-[4-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | CCNc1nc(NCC)nc(Nc2ccc(C(=O)/C=C/c3ccco3)cc2)n1 |
| InChI | InChI=1S/C20H22N6O2/c1-3-21-18-24-19(22-4-2)26-20(25-18)23-15-9-7-14(8-10-15)17(27)12-11-16-6-5-13-28-16/h5-13H,3-4H2,1-2H3,(H3,21,22,23,24,25,26)/b12-11+ |
| InChIKey | JUMYKLCZYLDPRS-VAWYXSNFSA-N |
| XLogP | 3.97 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|