C25H32N4O6 — CID 44522298
N-(3,5-dimethoxyphenyl)-2-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]-5-nitrobenzamide (PubChem CID 44522298) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]-5-nitrobenzamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 44522298 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]-5-nitrobenzamide |
| SMILES | COc1cc(NC(=O)c2cc([N+](=O)[O-])ccc2NC(=O)CNC2CCCC(C)C2C)cc(OC)c1 |
| InChI | InChI=1S/C25H32N4O6/c1-15-6-5-7-22(16(15)2)26-14-24(30)28-23-9-8-18(29(32)33)12-21(23)25(31)27-17-10-19(34-3)13-20(11-17)35-4/h8-13,15-16,22,26H,5-7,14H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | DFCIHROEZVINHK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|